C23H21ClFN3O4 — CID 91310499
2-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-nitrophenyl]methylamino]-3-phenylpropanamide (PubChem CID 91310499) has the molecular formula C23H21ClFN3O4 and a molecular weight of 457.89 g/mol. Its IUPAC name is 2-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-nitrophenyl]methylamino]-3-phenylpropanamide.
| Compound Name | 2-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-nitrophenyl]methylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 91310499 |
| Molecular Formula | C23H21ClFN3O4 |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[[4-[(2-chloro-6-fluorophenyl)methoxy]-3-nitrophenyl]methylamino]-3-phenylpropanamide |
| SMILES | NC(=O)C(Cc1ccccc1)NCc1ccc(OCc2c(F)cccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21ClFN3O4/c24-18-7-4-8-19(25)17(18)14-32-22-10-9-16(12-21(22)28(30)31)13-27-20(23(26)29)11-15-5-2-1-3-6-15/h1-10,12,20,27H,11,13-14H2,(H2,26,29) |
| InChIKey | AYCQWIPVEHDOBG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|