C21H19N5O5 — CID 175024441
1-[(4-methylphenyl)carbamoyl]-3-(3-nitrophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid (PubChem CID 175024441) has the molecular formula C21H19N5O5 and a molecular weight of 421.41 g/mol. Its IUPAC name is 1-[(4-methylphenyl)carbamoyl]-3-(3-nitrophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid.
| Compound Name | 1-[(4-methylphenyl)carbamoyl]-3-(3-nitrophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 175024441 |
| Molecular Formula | C21H19N5O5 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 1-[(4-methylphenyl)carbamoyl]-3-(3-nitrophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)c2nc(-c3cccc([N+](=O)[O-])c3)n3c2CN(C(=O)O)CC3)cc1 |
| InChI | InChI=1S/C21H19N5O5/c1-13-5-7-15(8-6-13)22-20(27)18-17-12-24(21(28)29)9-10-25(17)19(23-18)14-3-2-4-16(11-14)26(30)31/h2-8,11H,9-10,12H2,1H3,(H,22,27)(H,28,29) |
| InChIKey | ZXDSDSMKWZVBIO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|