C27H34FN3O3 — CID 175025943
[6-fluoro-2-(4-propan-2-yloxyanilino)-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl] acetate (PubChem CID 175025943) has the molecular formula C27H34FN3O3 and a molecular weight of 467.59 g/mol. Its IUPAC name is [6-fluoro-2-(4-propan-2-yloxyanilino)-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl] acetate.
| Compound Name | [6-fluoro-2-(4-propan-2-yloxyanilino)-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl] acetate |
|---|---|
| PubChem CID | 175025943 |
| Molecular Formula | C27H34FN3O3 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | [6-fluoro-2-(4-propan-2-yloxyanilino)-1-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl] acetate |
| SMILES | CC(=O)Oc1cc2nc(Nc3ccc(OC(C)C)cc3)n([C@@H]3C[C@H](C)CC(C)(C)C3)c2cc1F |
| InChI | InChI=1S/C27H34FN3O3/c1-16(2)33-21-9-7-19(8-10-21)29-26-30-23-13-25(34-18(4)32)22(28)12-24(23)31(26)20-11-17(3)14-27(5,6)15-20/h7-10,12-13,16-17,20H,11,14-15H2,1-6H3,(H,29,30)/t17-,20+/m0/s1 |
| InChIKey | OASVGPNYDSBDPA-FXAWDEMLSA-N |
| XLogP | 7.02 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|