About (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper
(2-aminoethylamino)oxy-butoxy-oxophosphanium;copper (PubChem CID 175026416) has the molecular formula C6H16CuN2O3P+
and a molecular weight of 258.72 g/mol. Its IUPAC name is (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper.
Molecular Properties
| Compound Name | (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper |
| PubChem CID | 175026416 |
| Molecular Formula | C6H16CuN2O3P+ |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper |
| SMILES | CCCCO[P+](=O)ONCCN.[Cu] |
| InChI | InChI=1S/C6H16N2O3P.Cu/c1-2-3-6-10-12(9)11-8-5-4-7;/h8H,2-7H2,1H3;/q+1; |
| InChIKey | BCHWGRGDBZFCPY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper?
The IUPAC name of (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper (CID 175026416) is (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper.
What is the SMILES notation for (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper?
The canonical SMILES for (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper is CCCCO[P+](=O)ONCCN.[Cu].
What is the InChIKey of (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper?
The InChIKey is BCHWGRGDBZFCPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O3P.Cu/c1-2-3-6-10-12(9)11-8-5-4-7;/h8H,2-7H2,1H3;/q+1;.
What are the key properties of (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper?
(2-aminoethylamino)oxy-butoxy-oxophosphanium;copper has a molecular weight of 258.72 g/mol, XLogP of 0.94, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminoethylamino)oxy-butoxy-oxophosphanium;copper is sourced from PubChem (CID 175026416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).