C11H16Cl2Zr — CID 175026827
dichlorozirconium;2-hex-1-enylcyclopenta-1,3-diene (PubChem CID 175026827) has the molecular formula C11H16Cl2Zr and a molecular weight of 310.38 g/mol. Its IUPAC name is dichlorozirconium;2-hex-1-enylcyclopenta-1,3-diene.
| Compound Name | dichlorozirconium;2-hex-1-enylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 175026827 |
| Molecular Formula | C11H16Cl2Zr |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | dichlorozirconium;2-hex-1-enylcyclopenta-1,3-diene |
| SMILES | CCCCC=CC1=CCC=C1.Cl[Zr]Cl |
| InChI | InChI=1S/C11H16.2ClH.Zr/c1-2-3-4-5-8-11-9-6-7-10-11;;;/h5-6,8-10H,2-4,7H2,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | ZCFGFJXBYSQLFX-UHFFFAOYSA-L |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|