About ethanol;naphthalene-1-carbonyl isothiocyanate
ethanol;naphthalene-1-carbonyl isothiocyanate (PubChem CID 175027163) has the molecular formula C14H13NO2S
and a molecular weight of 259.33 g/mol. Its IUPAC name is ethanol;naphthalene-1-carbonyl isothiocyanate.
Molecular Properties
| Compound Name | ethanol;naphthalene-1-carbonyl isothiocyanate |
| PubChem CID | 175027163 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | ethanol;naphthalene-1-carbonyl isothiocyanate |
| SMILES | CCO.O=C(N=C=S)c1cccc2ccccc12 |
| InChI | InChI=1S/C12H7NOS.C2H6O/c14-12(13-8-15)11-7-3-5-9-4-1-2-6-10(9)11;1-2-3/h1-7H;3H,2H2,1H3 |
| InChIKey | WVYSCTRORBFJGK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethanol;naphthalene-1-carbonyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;naphthalene-1-carbonyl isothiocyanate?
The IUPAC name of ethanol;naphthalene-1-carbonyl isothiocyanate (CID 175027163) is ethanol;naphthalene-1-carbonyl isothiocyanate.
What is the SMILES notation for ethanol;naphthalene-1-carbonyl isothiocyanate?
The canonical SMILES for ethanol;naphthalene-1-carbonyl isothiocyanate is CCO.O=C(N=C=S)c1cccc2ccccc12.
What is the InChIKey of ethanol;naphthalene-1-carbonyl isothiocyanate?
The InChIKey is WVYSCTRORBFJGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NOS.C2H6O/c14-12(13-8-15)11-7-3-5-9-4-1-2-6-10(9)11;1-2-3/h1-7H;3H,2H2,1H3.
What are the key properties of ethanol;naphthalene-1-carbonyl isothiocyanate?
ethanol;naphthalene-1-carbonyl isothiocyanate has a molecular weight of 259.33 g/mol, XLogP of 3.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;naphthalene-1-carbonyl isothiocyanate is sourced from PubChem (CID 175027163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).