C17H14NO6P — CID 175027496
[2-[(1E,4E)-5-(4-nitrophenyl)-3-oxopenta-1,4-dienyl]phenyl] dihydrogen phosphite (PubChem CID 175027496) has the molecular formula C17H14NO6P and a molecular weight of 359.27 g/mol. Its IUPAC name is [2-[(1E,4E)-5-(4-nitrophenyl)-3-oxopenta-1,4-dienyl]phenyl] dihydrogen phosphite.
| Compound Name | [2-[(1E,4E)-5-(4-nitrophenyl)-3-oxopenta-1,4-dienyl]phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 175027496 |
| Molecular Formula | C17H14NO6P |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [2-[(1E,4E)-5-(4-nitrophenyl)-3-oxopenta-1,4-dienyl]phenyl] dihydrogen phosphite |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)/C=C/c1ccccc1OP(O)O |
| InChI | InChI=1S/C17H14NO6P/c19-16(11-7-13-5-9-15(10-6-13)18(20)21)12-8-14-3-1-2-4-17(14)24-25(22)23/h1-12,22-23H/b11-7+,12-8+ |
| InChIKey | LXLDTKREDJQCMD-MKICQXMISA-N |
| XLogP | 3.48 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|