About butane-1,4-diamine;2-ethylperoxybenzaldehyde
butane-1,4-diamine;2-ethylperoxybenzaldehyde (PubChem CID 175027682) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is butane-1,4-diamine;2-ethylperoxybenzaldehyde.
Molecular Properties
| Compound Name | butane-1,4-diamine;2-ethylperoxybenzaldehyde |
| PubChem CID | 175027682 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | butane-1,4-diamine;2-ethylperoxybenzaldehyde |
| SMILES | CCOOc1ccccc1C=O.NCCCCN |
| InChI | InChI=1S/C9H10O3.C4H12N2/c1-2-11-12-9-6-4-3-5-8(9)7-10;5-3-1-2-4-6/h3-7H,2H2,1H3;1-6H2 |
| InChIKey | WEBSACKAVVTJAB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze butane-1,4-diamine;2-ethylperoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,4-diamine;2-ethylperoxybenzaldehyde?
The IUPAC name of butane-1,4-diamine;2-ethylperoxybenzaldehyde (CID 175027682) is butane-1,4-diamine;2-ethylperoxybenzaldehyde.
What is the SMILES notation for butane-1,4-diamine;2-ethylperoxybenzaldehyde?
The canonical SMILES for butane-1,4-diamine;2-ethylperoxybenzaldehyde is CCOOc1ccccc1C=O.NCCCCN.
What is the InChIKey of butane-1,4-diamine;2-ethylperoxybenzaldehyde?
The InChIKey is WEBSACKAVVTJAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.C4H12N2/c1-2-11-12-9-6-4-3-5-8(9)7-10;5-3-1-2-4-6/h3-7H,2H2,1H3;1-6H2.
What are the key properties of butane-1,4-diamine;2-ethylperoxybenzaldehyde?
butane-1,4-diamine;2-ethylperoxybenzaldehyde has a molecular weight of 254.33 g/mol, XLogP of 1.51, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,4-diamine;2-ethylperoxybenzaldehyde is sourced from PubChem (CID 175027682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).