C25H22N4O4S — CID 175027927
5-nitro-2-phenylmethoxy-N'-[1-[3-(1,3-thiazol-2-yl)phenyl]ethyl]benzohydrazide (PubChem CID 175027927) has the molecular formula C25H22N4O4S and a molecular weight of 474.54 g/mol. Its IUPAC name is 5-nitro-2-phenylmethoxy-N'-[1-[3-(1,3-thiazol-2-yl)phenyl]ethyl]benzohydrazide.
| Compound Name | 5-nitro-2-phenylmethoxy-N'-[1-[3-(1,3-thiazol-2-yl)phenyl]ethyl]benzohydrazide |
|---|---|
| PubChem CID | 175027927 |
| Molecular Formula | C25H22N4O4S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 5-nitro-2-phenylmethoxy-N'-[1-[3-(1,3-thiazol-2-yl)phenyl]ethyl]benzohydrazide |
| SMILES | CC(NNC(=O)c1cc([N+](=O)[O-])ccc1OCc1ccccc1)c1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C25H22N4O4S/c1-17(19-8-5-9-20(14-19)25-26-12-13-34-25)27-28-24(30)22-15-21(29(31)32)10-11-23(22)33-16-18-6-3-2-4-7-18/h2-15,17,27H,16H2,1H3,(H,28,30) |
| InChIKey | GLFWDMDUUQXWSS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|