C24H24N2O5 — CID 67659630
N-(2-hydroxyethyl)-3-[1-(5-nitro-2-phenylmethoxyphenyl)ethyl]benzamide (PubChem CID 67659630) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3-[1-(5-nitro-2-phenylmethoxyphenyl)ethyl]benzamide.
| Compound Name | N-(2-hydroxyethyl)-3-[1-(5-nitro-2-phenylmethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 67659630 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-(2-hydroxyethyl)-3-[1-(5-nitro-2-phenylmethoxyphenyl)ethyl]benzamide |
| SMILES | CC(c1cccc(C(=O)NCCO)c1)c1cc([N+](=O)[O-])ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H24N2O5/c1-17(19-8-5-9-20(14-19)24(28)25-12-13-27)22-15-21(26(29)30)10-11-23(22)31-16-18-6-3-2-4-7-18/h2-11,14-15,17,27H,12-13,16H2,1H3,(H,25,28) |
| InChIKey | JTUUESMZUVCPPU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|