C15H24N5O3S+ — CID 175029093
4-amino-N-pyrimidin-2-ylbenzenesulfonamide;2-hydroxyethyl(trimethyl)azanium (PubChem CID 175029093) has the molecular formula C15H24N5O3S+ and a molecular weight of 354.46 g/mol. Its IUPAC name is 4-amino-N-pyrimidin-2-ylbenzenesulfonamide;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 4-amino-N-pyrimidin-2-ylbenzenesulfonamide;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 175029093 |
| Molecular Formula | C15H24N5O3S+ |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-amino-N-pyrimidin-2-ylbenzenesulfonamide;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C10H10N4O2S.C5H14NO/c11-8-2-4-9(5-3-8)17(15,16)14-10-12-6-1-7-13-10;1-6(2,3)4-5-7/h1-7H,11H2,(H,12,13,14);7H,4-5H2,1-3H3/q;+1 |
| InChIKey | CECKVBAZMYAKJS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|