C30H37N5 — CID 175036602
3-propan-2-yl-2-(1H-pyrazol-4-yl)-5-[1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]-1H-indole (PubChem CID 175036602) has the molecular formula C30H37N5 and a molecular weight of 467.66 g/mol. Its IUPAC name is 3-propan-2-yl-2-(1H-pyrazol-4-yl)-5-[1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]-1H-indole.
| Compound Name | 3-propan-2-yl-2-(1H-pyrazol-4-yl)-5-[1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 175036602 |
| Molecular Formula | C30H37N5 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | 3-propan-2-yl-2-(1H-pyrazol-4-yl)-5-[1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]-1H-indole |
| SMILES | CC(C)c1c(-c2cn[nH]c2)[nH]c2ccc(C3CCN(Cc4ccc(N5CCCC5)cc4)CC3)cc12 |
| InChI | InChI=1S/C30H37N5/c1-21(2)29-27-17-24(7-10-28(27)33-30(29)25-18-31-32-19-25)23-11-15-34(16-12-23)20-22-5-8-26(9-6-22)35-13-3-4-14-35/h5-10,17-19,21,23,33H,3-4,11-16,20H2,1-2H3,(H,31,32) |
| InChIKey | VGBBZBOYCDGOFV-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|