C26H23N5O4 — CID 175036611
2-(2-acetamido-5-hydroxyphenyl)-N-methyl-1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzimidazole-5-carboxamide (PubChem CID 175036611) has the molecular formula C26H23N5O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is 2-(2-acetamido-5-hydroxyphenyl)-N-methyl-1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzimidazole-5-carboxamide.
| Compound Name | 2-(2-acetamido-5-hydroxyphenyl)-N-methyl-1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 175036611 |
| Molecular Formula | C26H23N5O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 2-(2-acetamido-5-hydroxyphenyl)-N-methyl-1-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzimidazole-5-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)nc(-c1cc(O)ccc1NC(C)=O)n2-c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C26H23N5O4/c1-14(32)28-21-8-6-18(33)13-19(21)25-30-22-12-16(26(35)27-2)3-9-23(22)31(25)17-5-7-20-15(11-17)4-10-24(34)29-20/h3,5-9,11-13,33H,4,10H2,1-2H3,(H,27,35)(H,28,32)(H,29,34) |
| InChIKey | PLNIIMYZJROPOE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|