About N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide
N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide (PubChem CID 58916400) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide.
Molecular Properties
| Compound Name | N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide |
| PubChem CID | 58916400 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)NC(=O)CN2 |
| InChI | InChI=1S/C10H11N3O2/c1-11-10(15)6-2-3-7-8(4-6)13-9(14)5-12-7/h2-4,12H,5H2,1H3,(H,11,15)(H,13,14) |
| InChIKey | DXWHRFBECJMIEI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide?
The IUPAC name of N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide (CID 58916400) is N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide.
What is the SMILES notation for N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide?
The canonical SMILES for N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide is CNC(=O)c1ccc2c(c1)NC(=O)CN2.
What is the InChIKey of N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide?
The InChIKey is DXWHRFBECJMIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-11-10(15)6-2-3-7-8(4-6)13-9(14)5-12-7/h2-4,12H,5H2,1H3,(H,11,15)(H,13,14).
What are the key properties of N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide?
N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide has a molecular weight of 205.22 g/mol, XLogP of 0.41, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide is sourced from PubChem (CID 58916400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).