C16H16N4O2S — CID 175038054
[3-[(aminocarbamothioylhydrazinylidene)methyl]phenyl] 2-phenylacetate (PubChem CID 175038054) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is [3-[(aminocarbamothioylhydrazinylidene)methyl]phenyl] 2-phenylacetate.
| Compound Name | [3-[(aminocarbamothioylhydrazinylidene)methyl]phenyl] 2-phenylacetate |
|---|---|
| PubChem CID | 175038054 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | [3-[(aminocarbamothioylhydrazinylidene)methyl]phenyl] 2-phenylacetate |
| SMILES | NNC(=S)NN=Cc1cccc(OC(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H16N4O2S/c17-19-16(23)20-18-11-13-7-4-8-14(9-13)22-15(21)10-12-5-2-1-3-6-12/h1-9,11H,10,17H2,(H2,19,20,23) |
| InChIKey | RIQWAOXKIPDPHW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|