C23H18ClN3O4 — CID 175038142
4-(4-amino-3-chlorophenoxy)-7-methoxy-2-phenoxyquinoline-6-carboxamide (PubChem CID 175038142) has the molecular formula C23H18ClN3O4 and a molecular weight of 435.87 g/mol. Its IUPAC name is 4-(4-amino-3-chlorophenoxy)-7-methoxy-2-phenoxyquinoline-6-carboxamide.
| Compound Name | 4-(4-amino-3-chlorophenoxy)-7-methoxy-2-phenoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 175038142 |
| Molecular Formula | C23H18ClN3O4 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 4-(4-amino-3-chlorophenoxy)-7-methoxy-2-phenoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nc(Oc3ccccc3)cc(Oc3ccc(N)c(Cl)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C23H18ClN3O4/c1-29-20-11-19-15(10-16(20)23(26)28)21(30-14-7-8-18(25)17(24)9-14)12-22(27-19)31-13-5-3-2-4-6-13/h2-12H,25H2,1H3,(H2,26,28) |
| InChIKey | VSUBSTUZMWTXCJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|