About copper(1+);5-phenyl-1H-imidazol-2-amine;iodide
copper(1+);5-phenyl-1H-imidazol-2-amine;iodide (PubChem CID 175039174) has the molecular formula C9H9CuIN3
and a molecular weight of 349.64 g/mol. Its IUPAC name is copper(1+);5-phenyl-1H-imidazol-2-amine;iodide.
Molecular Properties
| Compound Name | copper(1+);5-phenyl-1H-imidazol-2-amine;iodide |
| PubChem CID | 175039174 |
| Molecular Formula | C9H9CuIN3 |
| Molecular Weight | 349.64 g/mol |
| Exact Mass | 348.91 |
| IUPAC Name | copper(1+);5-phenyl-1H-imidazol-2-amine;iodide |
| SMILES | Nc1ncc(-c2ccccc2)[nH]1.[Cu+].[I-] |
| InChI | InChI=1S/C9H9N3.Cu.HI/c10-9-11-6-8(12-9)7-4-2-1-3-5-7;;/h1-6H,(H3,10,11,12);;1H/q;+1;/p-1 |
| InChIKey | CJYMJVKASRCXKF-UHFFFAOYSA-M |
| XLogP | -1.34 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.64 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);5-phenyl-1H-imidazol-2-amine;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);5-phenyl-1H-imidazol-2-amine;iodide?
The IUPAC name of copper(1+);5-phenyl-1H-imidazol-2-amine;iodide (CID 175039174) is copper(1+);5-phenyl-1H-imidazol-2-amine;iodide.
What is the SMILES notation for copper(1+);5-phenyl-1H-imidazol-2-amine;iodide?
The canonical SMILES for copper(1+);5-phenyl-1H-imidazol-2-amine;iodide is Nc1ncc(-c2ccccc2)[nH]1.[Cu+].[I-].
What is the InChIKey of copper(1+);5-phenyl-1H-imidazol-2-amine;iodide?
The InChIKey is CJYMJVKASRCXKF-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H9N3.Cu.HI/c10-9-11-6-8(12-9)7-4-2-1-3-5-7;;/h1-6H,(H3,10,11,12);;1H/q;+1;/p-1.
What are the key properties of copper(1+);5-phenyl-1H-imidazol-2-amine;iodide?
copper(1+);5-phenyl-1H-imidazol-2-amine;iodide has a molecular weight of 349.64 g/mol, XLogP of -1.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);5-phenyl-1H-imidazol-2-amine;iodide is sourced from PubChem (CID 175039174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).