C11H15Cl2N3 — CID 72716194
N-methyl-1-(5-phenyl-1H-imidazol-2-yl)methanamine;dihydrochloride (PubChem CID 72716194) has the molecular formula C11H15Cl2N3 and a molecular weight of 260.17 g/mol. Its IUPAC name is N-methyl-1-(5-phenyl-1H-imidazol-2-yl)methanamine;dihydrochloride.
| Compound Name | N-methyl-1-(5-phenyl-1H-imidazol-2-yl)methanamine;dihydrochloride |
|---|---|
| PubChem CID | 72716194 |
| Molecular Formula | C11H15Cl2N3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N-methyl-1-(5-phenyl-1H-imidazol-2-yl)methanamine;dihydrochloride |
| SMILES | CNCc1ncc(-c2ccccc2)[nH]1.Cl.Cl |
| InChI | InChI=1S/C11H13N3.2ClH/c1-12-8-11-13-7-10(14-11)9-5-3-2-4-6-9;;/h2-7,12H,8H2,1H3,(H,13,14);2*1H |
| InChIKey | HRMITNVPSOPSJJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |