C17H17ClN4S — CID 67214155
N-methyl-1-[5-(10H-phenothiazin-2-yl)-1H-imidazol-2-yl]methanamine;hydrochloride (PubChem CID 67214155) has the molecular formula C17H17ClN4S and a molecular weight of 344.87 g/mol. Its IUPAC name is N-methyl-1-[5-(10H-phenothiazin-2-yl)-1H-imidazol-2-yl]methanamine;hydrochloride.
| Compound Name | N-methyl-1-[5-(10H-phenothiazin-2-yl)-1H-imidazol-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 67214155 |
| Molecular Formula | C17H17ClN4S |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-methyl-1-[5-(10H-phenothiazin-2-yl)-1H-imidazol-2-yl]methanamine;hydrochloride |
| SMILES | CNCc1ncc(-c2ccc3c(c2)Nc2ccccc2S3)[nH]1.Cl |
| InChI | InChI=1S/C17H16N4S.ClH/c1-18-10-17-19-9-14(21-17)11-6-7-16-13(8-11)20-12-4-2-3-5-15(12)22-16;/h2-9,18,20H,10H2,1H3,(H,19,21);1H |
| InChIKey | YPKDCGYHCTVQHM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|