C23H33N5O3 — CID 175039590
N-[1-amino-4-[(2S,5S)-5-(1H-indol-3-ylmethyl)-3,6-dioxopiperazin-2-yl]butyl]hexanamide (PubChem CID 175039590) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[1-amino-4-[(2S,5S)-5-(1H-indol-3-ylmethyl)-3,6-dioxopiperazin-2-yl]butyl]hexanamide.
| Compound Name | N-[1-amino-4-[(2S,5S)-5-(1H-indol-3-ylmethyl)-3,6-dioxopiperazin-2-yl]butyl]hexanamide |
|---|---|
| PubChem CID | 175039590 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | N-[1-amino-4-[(2S,5S)-5-(1H-indol-3-ylmethyl)-3,6-dioxopiperazin-2-yl]butyl]hexanamide |
| SMILES | CCCCCC(=O)NC(N)CCC[C@@H]1NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C23H33N5O3/c1-2-3-4-12-21(29)28-20(24)11-7-10-18-22(30)27-19(23(31)26-18)13-15-14-25-17-9-6-5-8-16(15)17/h5-6,8-9,14,18-20,25H,2-4,7,10-13,24H2,1H3,(H,26,31)(H,27,30)(H,28,29)/t18-,19-,20?/m0/s1 |
| InChIKey | YQQQSFVCQZTWGI-NFBCFJMWSA-N |
| XLogP | 1.85 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|