About 4-fluorobutanoic acid;1-methylimidazole
4-fluorobutanoic acid;1-methylimidazole (PubChem CID 175040811) has the molecular formula C8H13FN2O2
and a molecular weight of 188.20 g/mol. Its IUPAC name is 4-fluorobutanoic acid;1-methylimidazole.
Molecular Properties
| Compound Name | 4-fluorobutanoic acid;1-methylimidazole |
| PubChem CID | 175040811 |
| Molecular Formula | C8H13FN2O2 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 4-fluorobutanoic acid;1-methylimidazole |
| SMILES | Cn1ccnc1.O=C(O)CCCF |
| InChI | InChI=1S/C4H7FO2.C4H6N2/c5-3-1-2-4(6)7;1-6-3-2-5-4-6/h1-3H2,(H,6,7);2-4H,1H3 |
| InChIKey | XTVCOZDPDQEFML-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluorobutanoic acid;1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobutanoic acid;1-methylimidazole?
The IUPAC name of 4-fluorobutanoic acid;1-methylimidazole (CID 175040811) is 4-fluorobutanoic acid;1-methylimidazole.
What is the SMILES notation for 4-fluorobutanoic acid;1-methylimidazole?
The canonical SMILES for 4-fluorobutanoic acid;1-methylimidazole is Cn1ccnc1.O=C(O)CCCF.
What is the InChIKey of 4-fluorobutanoic acid;1-methylimidazole?
The InChIKey is XTVCOZDPDQEFML-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7FO2.C4H6N2/c5-3-1-2-4(6)7;1-6-3-2-5-4-6/h1-3H2,(H,6,7);2-4H,1H3.
What are the key properties of 4-fluorobutanoic acid;1-methylimidazole?
4-fluorobutanoic acid;1-methylimidazole has a molecular weight of 188.20 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobutanoic acid;1-methylimidazole is sourced from PubChem (CID 175040811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).