C20H23ClN2O4S — CID 175042976
ethyl 5-chloro-4-[4-(3-oxomorpholin-4-yl)anilino]-3-propan-2-ylthiophene-2-carboxylate (PubChem CID 175042976) has the molecular formula C20H23ClN2O4S and a molecular weight of 422.93 g/mol. Its IUPAC name is ethyl 5-chloro-4-[4-(3-oxomorpholin-4-yl)anilino]-3-propan-2-ylthiophene-2-carboxylate.
| Compound Name | ethyl 5-chloro-4-[4-(3-oxomorpholin-4-yl)anilino]-3-propan-2-ylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 175042976 |
| Molecular Formula | C20H23ClN2O4S |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | ethyl 5-chloro-4-[4-(3-oxomorpholin-4-yl)anilino]-3-propan-2-ylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(Cl)c(Nc2ccc(N3CCOCC3=O)cc2)c1C(C)C |
| InChI | InChI=1S/C20H23ClN2O4S/c1-4-27-20(25)18-16(12(2)3)17(19(21)28-18)22-13-5-7-14(8-6-13)23-9-10-26-11-15(23)24/h5-8,12,22H,4,9-11H2,1-3H3 |
| InChIKey | UNLSISOYVGLATJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |