C17H23N3O6S — CID 110372453
ethyl 4-[4-(3-oxomorpholin-4-yl)phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 110372453) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is ethyl 4-[4-(3-oxomorpholin-4-yl)phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(3-oxomorpholin-4-yl)phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 110372453 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | ethyl 4-[4-(3-oxomorpholin-4-yl)phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2ccc(N3CCOCC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H23N3O6S/c1-2-26-17(22)18-7-9-19(10-8-18)27(23,24)15-5-3-14(4-6-15)20-11-12-25-13-16(20)21/h3-6H,2,7-13H2,1H3 |
| InChIKey | MVPPUCJCFUAQEZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |