C10H17N5O4S — CID 61108715
ethyl 4-[(5-amino-1H-pyrazol-4-yl)sulfonyl]piperazine-1-carboxylate (PubChem CID 61108715) has the molecular formula C10H17N5O4S and a molecular weight of 303.34 g/mol. Its IUPAC name is ethyl 4-[(5-amino-1H-pyrazol-4-yl)sulfonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(5-amino-1H-pyrazol-4-yl)sulfonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 61108715 |
| Molecular Formula | C10H17N5O4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | ethyl 4-[(5-amino-1H-pyrazol-4-yl)sulfonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2cn[nH]c2N)CC1 |
| InChI | InChI=1S/C10H17N5O4S/c1-2-19-10(16)14-3-5-15(6-4-14)20(17,18)8-7-12-13-9(8)11/h7H,2-6H2,1H3,(H3,11,12,13) |
| InChIKey | MUNFMFACCHBSMY-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |