C18H30N2O3 — CID 175043054
(3S)-3-amino-2-hydroxy-5-methyl-2-[(4-pentyl-2-pyridinyl)methyl]hexanoic acid (PubChem CID 175043054) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is (3S)-3-amino-2-hydroxy-5-methyl-2-[(4-pentyl-2-pyridinyl)methyl]hexanoic acid.
| Compound Name | (3S)-3-amino-2-hydroxy-5-methyl-2-[(4-pentyl-2-pyridinyl)methyl]hexanoic acid |
|---|---|
| PubChem CID | 175043054 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (3S)-3-amino-2-hydroxy-5-methyl-2-[(4-pentyl-2-pyridinyl)methyl]hexanoic acid |
| SMILES | CCCCCc1ccnc(CC(O)(C(=O)O)[C@@H](N)CC(C)C)c1 |
| InChI | InChI=1S/C18H30N2O3/c1-4-5-6-7-14-8-9-20-15(11-14)12-18(23,17(21)22)16(19)10-13(2)3/h8-9,11,13,16,23H,4-7,10,12,19H2,1-3H3,(H,21,22)/t16-,18?/m0/s1 |
| InChIKey | WPXBWPBAXRSSTR-ATNAJCNCSA-N |
| XLogP | 2.55 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|