C22H30N2O5 — CID 118549761
(2R,3S)-3-amino-2-hydroxy-5-methyl-2-[[4-(2-phenylmethoxyethoxy)-2-pyridinyl]methyl]hexanoic acid (PubChem CID 118549761) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is (2R,3S)-3-amino-2-hydroxy-5-methyl-2-[[4-(2-phenylmethoxyethoxy)-2-pyridinyl]methyl]hexanoic acid.
| Compound Name | (2R,3S)-3-amino-2-hydroxy-5-methyl-2-[[4-(2-phenylmethoxyethoxy)-2-pyridinyl]methyl]hexanoic acid |
|---|---|
| PubChem CID | 118549761 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (2R,3S)-3-amino-2-hydroxy-5-methyl-2-[[4-(2-phenylmethoxyethoxy)-2-pyridinyl]methyl]hexanoic acid |
| SMILES | CC(C)C[C@H](N)[C@](O)(Cc1cc(OCCOCc2ccccc2)ccn1)C(=O)O |
| InChI | InChI=1S/C22H30N2O5/c1-16(2)12-20(23)22(27,21(25)26)14-18-13-19(8-9-24-18)29-11-10-28-15-17-6-4-3-5-7-17/h3-9,13,16,20,27H,10-12,14-15,23H2,1-2H3,(H,25,26)/t20-,22+/m0/s1 |
| InChIKey | QLJREGWFANHMQE-RBBKRZOGSA-N |
| XLogP | 2.41 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|