About dioctylalumane;hexylalumane
dioctylalumane;hexylalumane (PubChem CID 175046144) has the molecular formula C22H50Al2
and a molecular weight of 368.61 g/mol. Its IUPAC name is dioctylalumane;hexylalumane.
Molecular Properties
| Compound Name | dioctylalumane;hexylalumane |
| PubChem CID | 175046144 |
| Molecular Formula | C22H50Al2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.35 |
| IUPAC Name | dioctylalumane;hexylalumane |
| SMILES | CCCCCCCC[AlH]CCCCCCCC.CCCCCC[AlH2] |
| InChI | InChI=1S/2C8H17.C6H13.2Al.3H/c2*1-3-5-7-8-6-4-2;1-3-5-6-4-2;;;;;/h2*1,3-8H2,2H3;1,3-6H2,2H3;;;;; |
| InChIKey | AIRQMUDURVJDHR-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dioctylalumane;hexylalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctylalumane;hexylalumane?
The IUPAC name of dioctylalumane;hexylalumane (CID 175046144) is dioctylalumane;hexylalumane.
What is the SMILES notation for dioctylalumane;hexylalumane?
The canonical SMILES for dioctylalumane;hexylalumane is CCCCCCCC[AlH]CCCCCCCC.CCCCCC[AlH2].
What is the InChIKey of dioctylalumane;hexylalumane?
The InChIKey is AIRQMUDURVJDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H17.C6H13.2Al.3H/c2*1-3-5-7-8-6-4-2;1-3-5-6-4-2;;;;;/h2*1,3-8H2,2H3;1,3-6H2,2H3;;;;;.
What are the key properties of dioctylalumane;hexylalumane?
dioctylalumane;hexylalumane has a molecular weight of 368.61 g/mol, XLogP of 7.60, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dioctylalumane;hexylalumane is sourced from PubChem (CID 175046144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).