About tert-butyl(oxo)silane;octylalumane
tert-butyl(oxo)silane;octylalumane (PubChem CID 175223496) has the molecular formula C12H29AlOSi
and a molecular weight of 244.43 g/mol. Its IUPAC name is tert-butyl(oxo)silane;octylalumane.
Molecular Properties
| Compound Name | tert-butyl(oxo)silane;octylalumane |
| PubChem CID | 175223496 |
| Molecular Formula | C12H29AlOSi |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | tert-butyl(oxo)silane;octylalumane |
| SMILES | CC(C)(C)[SiH]=O.CCCCCCCC[AlH2] |
| InChI | InChI=1S/C8H17.C4H10OSi.Al.2H/c1-3-5-7-8-6-4-2;1-4(2,3)6-5;;;/h1,3-8H2,2H3;6H,1-3H3;;; |
| InChIKey | YWPBURJJPLXNRL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(oxo)silane;octylalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(oxo)silane;octylalumane?
The IUPAC name of tert-butyl(oxo)silane;octylalumane (CID 175223496) is tert-butyl(oxo)silane;octylalumane.
What is the SMILES notation for tert-butyl(oxo)silane;octylalumane?
The canonical SMILES for tert-butyl(oxo)silane;octylalumane is CC(C)(C)[SiH]=O.CCCCCCCC[AlH2].
What is the InChIKey of tert-butyl(oxo)silane;octylalumane?
The InChIKey is YWPBURJJPLXNRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.C4H10OSi.Al.2H/c1-3-5-7-8-6-4-2;1-4(2,3)6-5;;;/h1,3-8H2,2H3;6H,1-3H3;;;.
What are the key properties of tert-butyl(oxo)silane;octylalumane?
tert-butyl(oxo)silane;octylalumane has a molecular weight of 244.43 g/mol, XLogP of 3.39, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(oxo)silane;octylalumane is sourced from PubChem (CID 175223496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).