C10H10F3NO2 — CID 175049799
2-(trideuteriomethoxy)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 175049799) has the molecular formula C10H10F3NO2 and a molecular weight of 236.21 g/mol. Its IUPAC name is 2-(trideuteriomethoxy)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-(trideuteriomethoxy)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 175049799 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-(trideuteriomethoxy)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | [2H]C([2H])([2H])Oc1ccccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H10F3NO2/c1-16-8-5-3-2-4-7(8)9(15)14-6-10(11,12)13/h2-5H,6H2,1H3,(H,14,15)/i1D3 |
| InChIKey | OPXCXJAHYZXBMT-FIBGUPNXSA-N |
| XLogP | 1.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |