C20H23FN4 — CID 175050362
(S)-(4-fluoro-5-pyridin-3-yl-1H-benzimidazol-2-yl)-(4-methylcyclohexyl)methanamine (PubChem CID 175050362) has the molecular formula C20H23FN4 and a molecular weight of 338.43 g/mol. Its IUPAC name is (S)-(4-fluoro-5-pyridin-3-yl-1H-benzimidazol-2-yl)-(4-methylcyclohexyl)methanamine.
| Compound Name | (S)-(4-fluoro-5-pyridin-3-yl-1H-benzimidazol-2-yl)-(4-methylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 175050362 |
| Molecular Formula | C20H23FN4 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (S)-(4-fluoro-5-pyridin-3-yl-1H-benzimidazol-2-yl)-(4-methylcyclohexyl)methanamine |
| SMILES | CC1CCC([C@H](N)c2nc3c(F)c(-c4cccnc4)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C20H23FN4/c1-12-4-6-13(7-5-12)18(22)20-24-16-9-8-15(17(21)19(16)25-20)14-3-2-10-23-11-14/h2-3,8-13,18H,4-7,22H2,1H3,(H,24,25)/t12?,13?,18-/m0/s1 |
| InChIKey | KXFKAMKMOLSCKP-KJBLDROHSA-N |
| XLogP | 4.59 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |