About 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride
4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride (PubChem CID 175051384) has the molecular formula C11H21Cl2N3O
and a molecular weight of 282.21 g/mol. Its IUPAC name is 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride.
Molecular Properties
| Compound Name | 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride |
| PubChem CID | 175051384 |
| Molecular Formula | C11H21Cl2N3O |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride |
| SMILES | COC1=C(C2CCNCC2)CNC(N)=C1.Cl.Cl |
| InChI | InChI=1S/C11H19N3O.2ClH/c1-15-10-6-11(12)14-7-9(10)8-2-4-13-5-3-8;;/h6,8,13-14H,2-5,7,12H2,1H3;2*1H |
| InChIKey | BORMLAQWSUNDBQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride?
The IUPAC name of 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride (CID 175051384) is 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride.
What is the SMILES notation for 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride?
The canonical SMILES for 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride is COC1=C(C2CCNCC2)CNC(N)=C1.Cl.Cl.
What is the InChIKey of 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride?
The InChIKey is BORMLAQWSUNDBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O.2ClH/c1-15-10-6-11(12)14-7-9(10)8-2-4-13-5-3-8;;/h6,8,13-14H,2-5,7,12H2,1H3;2*1H.
What are the key properties of 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride?
4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride has a molecular weight of 282.21 g/mol, XLogP of 1.13, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine;dihydrochloride is sourced from PubChem (CID 175051384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).