C11H19N3O — CID 175051385
4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine (PubChem CID 175051385) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine.
| Compound Name | 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 175051385 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-methoxy-3-piperidin-4-yl-1,2-dihydropyridin-6-amine |
| SMILES | COC1=C(C2CCNCC2)CNC(N)=C1 |
| InChI | InChI=1S/C11H19N3O/c1-15-10-6-11(12)14-7-9(10)8-2-4-13-5-3-8/h6,8,13-14H,2-5,7,12H2,1H3 |
| InChIKey | GJMKHSVHGLFWEG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |