C14H25NO — CID 143617057
ethane;4-[(3Z)-4-methoxyhexa-1,3,5-trien-3-yl]piperidine (PubChem CID 143617057) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;4-[(3Z)-4-methoxyhexa-1,3,5-trien-3-yl]piperidine.
| Compound Name | ethane;4-[(3Z)-4-methoxyhexa-1,3,5-trien-3-yl]piperidine |
|---|---|
| PubChem CID | 143617057 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | ethane;4-[(3Z)-4-methoxyhexa-1,3,5-trien-3-yl]piperidine |
| SMILES | C=C/C(OC)=C(\C=C)C1CCNCC1.CC |
| InChI | InChI=1S/C12H19NO.C2H6/c1-4-11(12(5-2)14-3)10-6-8-13-9-7-10;1-2/h4-5,10,13H,1-2,6-9H2,3H3;1-2H3/b12-11-; |
| InChIKey | QRKRAUUBVUMEFO-AFEZEDKISA-N |
| XLogP | 3.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|