C12H20N2O — CID 143984945
5-methoxy-3-(piperidin-4-ylmethyl)-1,2-dihydropyridine (PubChem CID 143984945) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 5-methoxy-3-(piperidin-4-ylmethyl)-1,2-dihydropyridine.
| Compound Name | 5-methoxy-3-(piperidin-4-ylmethyl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 143984945 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 5-methoxy-3-(piperidin-4-ylmethyl)-1,2-dihydropyridine |
| SMILES | COC1=CNCC(CC2CCNCC2)=C1 |
| InChI | InChI=1S/C12H20N2O/c1-15-12-7-11(8-14-9-12)6-10-2-4-13-5-3-10/h7,9-10,13-14H,2-6,8H2,1H3 |
| InChIKey | ZYJVYAGELSYZSV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |