C15H24N2O — CID 143996935
(3E)-3-[(3E,5Z)-4-methoxy-5-methylocta-3,5,7-trienylidene]piperidin-2-amine (PubChem CID 143996935) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (3E)-3-[(3E,5Z)-4-methoxy-5-methylocta-3,5,7-trienylidene]piperidin-2-amine.
| Compound Name | (3E)-3-[(3E,5Z)-4-methoxy-5-methylocta-3,5,7-trienylidene]piperidin-2-amine |
|---|---|
| PubChem CID | 143996935 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (3E)-3-[(3E,5Z)-4-methoxy-5-methylocta-3,5,7-trienylidene]piperidin-2-amine |
| SMILES | C=C/C=C(C)\C(=C/C/C=C1\CCCNC1N)OC |
| InChI | InChI=1S/C15H24N2O/c1-4-7-12(2)14(18-3)10-5-8-13-9-6-11-17-15(13)16/h4,7-8,10,15,17H,1,5-6,9,11,16H2,2-3H3/b12-7-,13-8+,14-10+ |
| InChIKey | JBILPSWYGZRTMN-JVQALEFTSA-N |
| XLogP | 2.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|