C15H23NO — CID 143024917
(3Z)-3-[(2E)-2-methoxypenta-2,4-dienylidene]-2,4,6,6-tetramethyl-1,2-dihydropyridine (PubChem CID 143024917) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (3Z)-3-[(2E)-2-methoxypenta-2,4-dienylidene]-2,4,6,6-tetramethyl-1,2-dihydropyridine.
| Compound Name | (3Z)-3-[(2E)-2-methoxypenta-2,4-dienylidene]-2,4,6,6-tetramethyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 143024917 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (3Z)-3-[(2E)-2-methoxypenta-2,4-dienylidene]-2,4,6,6-tetramethyl-1,2-dihydropyridine |
| SMILES | C=C/C=C(\C=C1\C(C)=CC(C)(C)NC1C)OC |
| InChI | InChI=1S/C15H23NO/c1-7-8-13(17-6)9-14-11(2)10-15(4,5)16-12(14)3/h7-10,12,16H,1H2,2-6H3/b13-8+,14-9- |
| InChIKey | JXANXJSHDQMDSQ-MGDWIPCISA-N |
| XLogP | 3.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|