C15H17O3P — CID 175052143
1,1-diphenoxypropoxyphosphane (PubChem CID 175052143) has the molecular formula C15H17O3P and a molecular weight of 276.27 g/mol. Its IUPAC name is 1,1-diphenoxypropoxyphosphane.
| Compound Name | 1,1-diphenoxypropoxyphosphane |
|---|---|
| PubChem CID | 175052143 |
| Molecular Formula | C15H17O3P |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 1,1-diphenoxypropoxyphosphane |
| SMILES | CCC(OP)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C15H17O3P/c1-2-15(18-19,16-13-9-5-3-6-10-13)17-14-11-7-4-8-12-14/h3-12H,2,19H2,1H3 |
| InChIKey | FUZUCWWWXPPASG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|