C26H31N3O7 — CID 175053743
ethyl 4-amino-5-[3-[[3-(2-hydroxyethoxy)-2-methoxybenzoyl]amino]propoxy]-2-methylquinoline-3-carboxylate (PubChem CID 175053743) has the molecular formula C26H31N3O7 and a molecular weight of 497.55 g/mol. Its IUPAC name is ethyl 4-amino-5-[3-[[3-(2-hydroxyethoxy)-2-methoxybenzoyl]amino]propoxy]-2-methylquinoline-3-carboxylate.
| Compound Name | ethyl 4-amino-5-[3-[[3-(2-hydroxyethoxy)-2-methoxybenzoyl]amino]propoxy]-2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 175053743 |
| Molecular Formula | C26H31N3O7 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | ethyl 4-amino-5-[3-[[3-(2-hydroxyethoxy)-2-methoxybenzoyl]amino]propoxy]-2-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc2cccc(OCCCNC(=O)c3cccc(OCCO)c3OC)c2c1N |
| InChI | InChI=1S/C26H31N3O7/c1-4-34-26(32)21-16(2)29-18-9-6-10-19(22(18)23(21)27)35-14-7-12-28-25(31)17-8-5-11-20(24(17)33-3)36-15-13-30/h5-6,8-11,30H,4,7,12-15H2,1-3H3,(H2,27,29)(H,28,31) |
| InChIKey | CEJDKUUSPUPQHC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|