C11H17O3S+ — CID 175053958
(4-formyl-1-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-oxosulfanium (PubChem CID 175053958) has the molecular formula C11H17O3S+ and a molecular weight of 229.32 g/mol. Its IUPAC name is (4-formyl-1-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-oxosulfanium.
| Compound Name | (4-formyl-1-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-oxosulfanium |
|---|---|
| PubChem CID | 175053958 |
| Molecular Formula | C11H17O3S+ |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (4-formyl-1-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-oxosulfanium |
| SMILES | O=CC1CC([S+]=O)C(O)C2CCCCC12 |
| InChI | InChI=1S/C11H17O3S/c12-6-7-5-10(15-14)11(13)9-4-2-1-3-8(7)9/h6-11,13H,1-5H2/q+1 |
| InChIKey | RUQSPWWITBGUMG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|