C10H11NO3S — CID 175056234
2-formyl-7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylic acid (PubChem CID 175056234) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-formyl-7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylic acid.
| Compound Name | 2-formyl-7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 175056234 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2-formyl-7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylic acid |
| SMILES | CC1c2sc(C=O)cc2CCN1C(=O)O |
| InChI | InChI=1S/C10H11NO3S/c1-6-9-7(4-8(5-12)15-9)2-3-11(6)10(13)14/h4-6H,2-3H2,1H3,(H,13,14) |
| InChIKey | ODLJAIRPBMHWCD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|