C12H23NO4 — CID 175057752
4-[bis(2-hydroxyethyl)amino]-5-hydroxy-4,5-dimethylhex-1-en-3-one (PubChem CID 175057752) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-[bis(2-hydroxyethyl)amino]-5-hydroxy-4,5-dimethylhex-1-en-3-one.
| Compound Name | 4-[bis(2-hydroxyethyl)amino]-5-hydroxy-4,5-dimethylhex-1-en-3-one |
|---|---|
| PubChem CID | 175057752 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 4-[bis(2-hydroxyethyl)amino]-5-hydroxy-4,5-dimethylhex-1-en-3-one |
| SMILES | C=CC(=O)C(C)(N(CCO)CCO)C(C)(C)O |
| InChI | InChI=1S/C12H23NO4/c1-5-10(16)12(4,11(2,3)17)13(6-8-14)7-9-15/h5,14-15,17H,1,6-9H2,2-4H3 |
| InChIKey | LAAQJHXMUJIGBS-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|