C20H36O4 — CID 175059476
oxiran-2-yl (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 175059476) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is oxiran-2-yl (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | oxiran-2-yl (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 175059476 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | oxiran-2-yl (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OC1CO1 |
| InChI | InChI=1S/C20H36O4/c1-2-3-4-11-14-18(21)15-12-9-7-5-6-8-10-13-16-19(22)24-20-17-23-20/h9,12,18,20-21H,2-8,10-11,13-17H2,1H3/b12-9-/t18-,20?/m1/s1 |
| InChIKey | HVLYMPMGOPROFT-WAZCKVAXSA-N |
| XLogP | 4.89 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|