C19H28O4 — CID 175059967
3-[3-(2,2-dimethoxyoctyl)phenyl]prop-2-enoic acid (PubChem CID 175059967) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 3-[3-(2,2-dimethoxyoctyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(2,2-dimethoxyoctyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175059967 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 3-[3-(2,2-dimethoxyoctyl)phenyl]prop-2-enoic acid |
| SMILES | CCCCCCC(Cc1cccc(C=CC(=O)O)c1)(OC)OC |
| InChI | InChI=1S/C19H28O4/c1-4-5-6-7-13-19(22-2,23-3)15-17-10-8-9-16(14-17)11-12-18(20)21/h8-12,14H,4-7,13,15H2,1-3H3,(H,20,21) |
| InChIKey | HYZBOHOGEMXRBU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|