C23H24N7O2+ — CID 175061589
3-[4-(benzylamino)-5,6,7,9-tetrahydro-[1,2,4]triazino[1,6-c][1,3]oxazepin-10-ium-2-yl]-2-methylpyrazolo[1,5-a]pyridine-7-carboxamide (PubChem CID 175061589) has the molecular formula C23H24N7O2+ and a molecular weight of 430.49 g/mol. Its IUPAC name is 3-[4-(benzylamino)-5,6,7,9-tetrahydro-[1,2,4]triazino[1,6-c][1,3]oxazepin-10-ium-2-yl]-2-methylpyrazolo[1,5-a]pyridine-7-carboxamide.
| Compound Name | 3-[4-(benzylamino)-5,6,7,9-tetrahydro-[1,2,4]triazino[1,6-c][1,3]oxazepin-10-ium-2-yl]-2-methylpyrazolo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 175061589 |
| Molecular Formula | C23H24N7O2+ |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3-[4-(benzylamino)-5,6,7,9-tetrahydro-[1,2,4]triazino[1,6-c][1,3]oxazepin-10-ium-2-yl]-2-methylpyrazolo[1,5-a]pyridine-7-carboxamide |
| SMILES | Cc1nn2c(C(N)=O)cccc2c1-c1nc(NCc2ccccc2)c2[n+](n1)COCCC2 |
| InChI | InChI=1S/C23H23N7O2/c1-15-20(17-9-5-10-18(21(24)31)30(17)27-15)23-26-22(25-13-16-7-3-2-4-8-16)19-11-6-12-32-14-29(19)28-23/h2-5,7-10H,6,11-14H2,1H3,(H2-,24,25,26,28,31)/p+1 |
| InChIKey | PNGGUTASEGHXOW-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|