C23H21N5O2S — CID 118239553
3-[4-(benzylamino)-5,7,8,9-tetrahydrooxepino[4,3-d]pyrimidin-2-yl]-2,1-benzothiazole-7-carboxamide (PubChem CID 118239553) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is 3-[4-(benzylamino)-5,7,8,9-tetrahydrooxepino[4,3-d]pyrimidin-2-yl]-2,1-benzothiazole-7-carboxamide.
| Compound Name | 3-[4-(benzylamino)-5,7,8,9-tetrahydrooxepino[4,3-d]pyrimidin-2-yl]-2,1-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 118239553 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 3-[4-(benzylamino)-5,7,8,9-tetrahydrooxepino[4,3-d]pyrimidin-2-yl]-2,1-benzothiazole-7-carboxamide |
| SMILES | NC(=O)c1cccc2c(-c3nc4c(c(NCc5ccccc5)n3)COCCC4)snc12 |
| InChI | InChI=1S/C23H21N5O2S/c24-21(29)16-9-4-8-15-19(16)28-31-20(15)23-26-18-10-5-11-30-13-17(18)22(27-23)25-12-14-6-2-1-3-7-14/h1-4,6-9H,5,10-13H2,(H2,24,29)(H,25,26,27) |
| InChIKey | VGUFOKRHGVYMDW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |