C24H24N6OS — CID 118239597
3-[4-(benzylamino)-8-methyl-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-2-yl]-2,1-benzothiazole-7-carboxamide (PubChem CID 118239597) has the molecular formula C24H24N6OS and a molecular weight of 444.56 g/mol. Its IUPAC name is 3-[4-(benzylamino)-8-methyl-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-2-yl]-2,1-benzothiazole-7-carboxamide.
| Compound Name | 3-[4-(benzylamino)-8-methyl-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-2-yl]-2,1-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 118239597 |
| Molecular Formula | C24H24N6OS |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 3-[4-(benzylamino)-8-methyl-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-2-yl]-2,1-benzothiazole-7-carboxamide |
| SMILES | CN1CCCc2c(nc(-c3snc4c(C(N)=O)cccc34)nc2NCc2ccccc2)C1 |
| InChI | InChI=1S/C24H24N6OS/c1-30-12-6-11-16-19(14-30)27-24(28-23(16)26-13-15-7-3-2-4-8-15)21-17-9-5-10-18(22(25)31)20(17)29-32-21/h2-5,7-10H,6,11-14H2,1H3,(H2,25,31)(H,26,27,28) |
| InChIKey | FPSOETXAZHSWCA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |