C22H20N6OS — CID 118239600
3-[4-(benzylamino)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-2-yl]-2,1-benzothiazole-7-carboxamide (PubChem CID 118239600) has the molecular formula C22H20N6OS and a molecular weight of 416.51 g/mol. Its IUPAC name is 3-[4-(benzylamino)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-2-yl]-2,1-benzothiazole-7-carboxamide.
| Compound Name | 3-[4-(benzylamino)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-2-yl]-2,1-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 118239600 |
| Molecular Formula | C22H20N6OS |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-[4-(benzylamino)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-2-yl]-2,1-benzothiazole-7-carboxamide |
| SMILES | NC(=O)c1cccc2c(-c3nc4c(c(NCc5ccccc5)n3)NCCC4)snc12 |
| InChI | InChI=1S/C22H20N6OS/c23-20(29)15-9-4-8-14-17(15)28-30-19(14)22-26-16-10-5-11-24-18(16)21(27-22)25-12-13-6-2-1-3-7-13/h1-4,6-9,24H,5,10-12H2,(H2,23,29)(H,25,26,27) |
| InChIKey | BXSDTOPXIGHFJY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |