C23H22N6OS — CID 118239758
3-[4-(benzylamino)-6,7,8,9-tetrahydro-5H-pyrimido[5,4-b]azepin-2-yl]-1,2-benzothiazole-7-carboxamide (PubChem CID 118239758) has the molecular formula C23H22N6OS and a molecular weight of 430.54 g/mol. Its IUPAC name is 3-[4-(benzylamino)-6,7,8,9-tetrahydro-5H-pyrimido[5,4-b]azepin-2-yl]-1,2-benzothiazole-7-carboxamide.
| Compound Name | 3-[4-(benzylamino)-6,7,8,9-tetrahydro-5H-pyrimido[5,4-b]azepin-2-yl]-1,2-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 118239758 |
| Molecular Formula | C23H22N6OS |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-[4-(benzylamino)-6,7,8,9-tetrahydro-5H-pyrimido[5,4-b]azepin-2-yl]-1,2-benzothiazole-7-carboxamide |
| SMILES | NC(=O)c1cccc2c(-c3nc4c(c(NCc5ccccc5)n3)NCCCC4)nsc12 |
| InChI | InChI=1S/C23H22N6OS/c24-21(30)16-10-6-9-15-18(29-31-20(15)16)23-27-17-11-4-5-12-25-19(17)22(28-23)26-13-14-7-2-1-3-8-14/h1-3,6-10,25H,4-5,11-13H2,(H2,24,30)(H,26,27,28) |
| InChIKey | FSBJZMMFCIICFB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |