C16H32N2O2 — CID 175062034
3-(4,5-dihydroimidazol-1-yl)tridecane-1,1-diol (PubChem CID 175062034) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 3-(4,5-dihydroimidazol-1-yl)tridecane-1,1-diol.
| Compound Name | 3-(4,5-dihydroimidazol-1-yl)tridecane-1,1-diol |
|---|---|
| PubChem CID | 175062034 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 3-(4,5-dihydroimidazol-1-yl)tridecane-1,1-diol |
| SMILES | CCCCCCCCCCC(CC(O)O)N1C=NCC1 |
| InChI | InChI=1S/C16H32N2O2/c1-2-3-4-5-6-7-8-9-10-15(13-16(19)20)18-12-11-17-14-18/h14-16,19-20H,2-13H2,1H3 |
| InChIKey | VZFJMXXBOQZEMT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|