C8H17N3 — CID 70539508
1-(4,5-dihydroimidazol-1-yl)pentan-1-amine (PubChem CID 70539508) has the molecular formula C8H17N3 and a molecular weight of 155.25 g/mol. Its IUPAC name is 1-(4,5-dihydroimidazol-1-yl)pentan-1-amine.
| Compound Name | 1-(4,5-dihydroimidazol-1-yl)pentan-1-amine |
|---|---|
| PubChem CID | 70539508 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1-(4,5-dihydroimidazol-1-yl)pentan-1-amine |
| SMILES | CCCCC(N)N1C=NCC1 |
| InChI | InChI=1S/C8H17N3/c1-2-3-4-8(9)11-6-5-10-7-11/h7-8H,2-6,9H2,1H3 |
| InChIKey | JBLVUYNJCKSGJZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |